C21H30N2OS — CID 163372420
3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-prop-2-enylthiourea (PubChem CID 163372420) has the molecular formula C21H30N2OS and a molecular weight of 358.55 g/mol. Its IUPAC name is 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-prop-2-enylthiourea.
| Compound Name | 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-prop-2-enylthiourea |
|---|---|
| PubChem CID | 163372420 |
| Molecular Formula | C21H30N2OS |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-prop-2-enylthiourea |
| SMILES | C=CCN(C)C(=S)Nc1cc(C)c(C(=O)CC2CCCCC2)cc1C |
| InChI | InChI=1S/C21H30N2OS/c1-5-11-23(4)21(25)22-19-13-15(2)18(12-16(19)3)20(24)14-17-9-7-6-8-10-17/h5,12-13,17H,1,6-11,14H2,2-4H3,(H,22,25) |
| InChIKey | MWACGOMRGDTLDY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|