C21H32N2OS — CID 163372458
3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-propan-2-ylthiourea (PubChem CID 163372458) has the molecular formula C21H32N2OS and a molecular weight of 360.57 g/mol. Its IUPAC name is 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-propan-2-ylthiourea.
| Compound Name | 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 163372458 |
| Molecular Formula | C21H32N2OS |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-[4-(2-cyclohexylacetyl)-2,5-dimethylphenyl]-1-methyl-1-propan-2-ylthiourea |
| SMILES | Cc1cc(C(=O)CC2CCCCC2)c(C)cc1NC(=S)N(C)C(C)C |
| InChI | InChI=1S/C21H32N2OS/c1-14(2)23(5)21(25)22-19-12-15(3)18(11-16(19)4)20(24)13-17-9-7-6-8-10-17/h11-12,14,17H,6-10,13H2,1-5H3,(H,22,25) |
| InChIKey | UWNUNNHVEDETNS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|