C12H16N4 — CID 67447570
N-ethyl-N-methyl-N'-(6-methyl-1H-indazol-5-yl)methanimidamide (PubChem CID 67447570) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-ethyl-N-methyl-N'-(6-methyl-1H-indazol-5-yl)methanimidamide.
| Compound Name | N-ethyl-N-methyl-N'-(6-methyl-1H-indazol-5-yl)methanimidamide |
|---|---|
| PubChem CID | 67447570 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-ethyl-N-methyl-N'-(6-methyl-1H-indazol-5-yl)methanimidamide |
| SMILES | CCN(C)/C=N/c1cc2cn[nH]c2cc1C |
| InChI | InChI=1S/C12H16N4/c1-4-16(3)8-13-11-6-10-7-14-15-12(10)5-9(11)2/h5-8H,4H2,1-3H3,(H,14,15)/b13-8+ |
| InChIKey | PJHZBGZPVXVWDH-MDWZMJQESA-N |
| XLogP | 2.48 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|