About 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide
1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide (PubChem CID 83093269) has the molecular formula C9H11BrN4O2S
and a molecular weight of 319.18 g/mol. Its IUPAC name is 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide |
| PubChem CID | 83093269 |
| Molecular Formula | C9H11BrN4O2S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide |
| SMILES | Cc1nn(C)c2ncc(NS(=O)(=O)CBr)cc12 |
| InChI | InChI=1S/C9H11BrN4O2S/c1-6-8-3-7(13-17(15,16)5-10)4-11-9(8)14(2)12-6/h3-4,13H,5H2,1-2H3 |
| InChIKey | ZSUSXSUZJSDFIZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide (CID 83093269) is 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide is Cc1nn(C)c2ncc(NS(=O)(=O)CBr)cc12.
What is the InChIKey of 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide?
The InChIKey is ZSUSXSUZJSDFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN4O2S/c1-6-8-3-7(13-17(15,16)5-10)4-11-9(8)14(2)12-6/h3-4,13H,5H2,1-2H3.
What are the key properties of 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide?
1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide has a molecular weight of 319.18 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanesulfonamide is sourced from PubChem (CID 83093269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).