C14H22N4 — CID 104720212
N-hexan-3-yl-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (PubChem CID 104720212) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-hexan-3-yl-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine.
| Compound Name | N-hexan-3-yl-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 104720212 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-hexan-3-yl-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| SMILES | CCCC(CC)Nc1cnc2c(c1)c(C)nn2C |
| InChI | InChI=1S/C14H22N4/c1-5-7-11(6-2)16-12-8-13-10(3)17-18(4)14(13)15-9-12/h8-9,11,16H,5-7H2,1-4H3 |
| InChIKey | MUMRXLFSLFZYFG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |