C16H24BNO2SSi — CID 76848426
trimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridin-2-yl]silane (PubChem CID 76848426) has the molecular formula C16H24BNO2SSi and a molecular weight of 333.34 g/mol. Its IUPAC name is trimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridin-2-yl]silane.
| Compound Name | trimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridin-2-yl]silane |
|---|---|
| PubChem CID | 76848426 |
| Molecular Formula | C16H24BNO2SSi |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | trimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridin-2-yl]silane |
| SMILES | CC1(C)OB(c2cnc3sc([Si](C)(C)C)cc3c2)OC1(C)C |
| InChI | InChI=1S/C16H24BNO2SSi/c1-15(2)16(3,4)20-17(19-15)12-8-11-9-13(22(5,6)7)21-14(11)18-10-12/h8-10H,1-7H3 |
| InChIKey | ZAUCHSTVEHVLGT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|