C16H31BO2SSi2 — CID 56973120
trimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilylthiophen-2-yl]silane (PubChem CID 56973120) has the molecular formula C16H31BO2SSi2 and a molecular weight of 354.47 g/mol. Its IUPAC name is trimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilylthiophen-2-yl]silane.
| Compound Name | trimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilylthiophen-2-yl]silane |
|---|---|
| PubChem CID | 56973120 |
| Molecular Formula | C16H31BO2SSi2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | trimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilylthiophen-2-yl]silane |
| SMILES | CC1(C)OB(c2cc([Si](C)(C)C)sc2[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C16H31BO2SSi2/c1-15(2)16(3,4)19-17(18-15)12-11-13(21(5,6)7)20-14(12)22(8,9)10/h11H,1-10H3 |
| InChIKey | URKVBLZAMHLDGR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|