C13H16BClIN2O2P — CID 170726626
[5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-iodophosphane (PubChem CID 170726626) has the molecular formula C13H16BClIN2O2P and a molecular weight of 436.43 g/mol. Its IUPAC name is [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-iodophosphane.
| Compound Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-iodophosphane |
|---|---|
| PubChem CID | 170726626 |
| Molecular Formula | C13H16BClIN2O2P |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]-iodophosphane |
| SMILES | CC1(C)OB(c2c(Cl)ccc3c2cnn3PI)OC1(C)C |
| InChI | InChI=1S/C13H16BClIN2O2P/c1-12(2)13(3,4)20-14(19-12)11-8-7-17-18(21-16)10(8)6-5-9(11)15/h5-7,21H,1-4H3 |
| InChIKey | WQBGAHMTROEEOQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|