C14H19BIN2O2P — CID 145234379
iodo-[5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phosphane (PubChem CID 145234379) has the molecular formula C14H19BIN2O2P and a molecular weight of 416.01 g/mol. Its IUPAC name is iodo-[5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phosphane.
| Compound Name | iodo-[5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phosphane |
|---|---|
| PubChem CID | 145234379 |
| Molecular Formula | C14H19BIN2O2P |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | iodo-[5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phosphane |
| SMILES | Cc1cc2cnn(PI)c2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H19BIN2O2P/c1-9-6-10-8-17-18(21-16)12(10)7-11(9)15-19-13(2,3)14(4,5)20-15/h6-8,21H,1-5H3 |
| InChIKey | VZUVQFZJWVMJKW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|