C19H21BClN3O2 — CID 140798284
1-(3-chloro-6-methyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 140798284) has the molecular formula C19H21BClN3O2 and a molecular weight of 369.66 g/mol. Its IUPAC name is 1-(3-chloro-6-methyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-(3-chloro-6-methyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 140798284 |
| Molecular Formula | C19H21BClN3O2 |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-(3-chloro-6-methyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cc1ccc(Cl)c(-n2ncc3ccc(B4OC(C)(C)C(C)(C)O4)cc32)n1 |
| InChI | InChI=1S/C19H21BClN3O2/c1-12-6-9-15(21)17(23-12)24-16-10-14(8-7-13(16)11-22-24)20-25-18(2,3)19(4,5)26-20/h6-11H,1-5H3 |
| InChIKey | GUCGMBXLIKAAOG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|