C10H16BNO4 — CID 172644085
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (PubChem CID 172644085) has the molecular formula C10H16BNO4 and a molecular weight of 225.05 g/mol. Its IUPAC name is 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole.
| Compound Name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 172644085 |
| Molecular Formula | C10H16BNO4 |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| SMILES | COc1nc(B2OC(C)(C)C(C)(C)O2)co1 |
| InChI | InChI=1S/C10H16BNO4/c1-9(2)10(3,4)16-11(15-9)7-6-14-8(12-7)13-5/h6H,1-5H3 |
| InChIKey | OUDXMTQVRNVWJZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|