C16H20BFN2O3 — CID 172644621
2-fluoro-1-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole (PubChem CID 172644621) has the molecular formula C16H20BFN2O3 and a molecular weight of 318.16 g/mol. Its IUPAC name is 2-fluoro-1-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole.
| Compound Name | 2-fluoro-1-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole |
|---|---|
| PubChem CID | 172644621 |
| Molecular Formula | C16H20BFN2O3 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-fluoro-1-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole |
| SMILES | COc1ccc(-n2cc(B3OC(C)(C)C(C)(C)O3)nc2F)cc1 |
| InChI | InChI=1S/C16H20BFN2O3/c1-15(2)16(3,4)23-17(22-15)13-10-20(14(18)19-13)11-6-8-12(21-5)9-7-11/h6-10H,1-5H3 |
| InChIKey | HUHOULNSQXABNS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|