C23H31BClNO5 — CID 140765718
4-[4-(5-chloro-2-methoxyphenyl)butoxy]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 140765718) has the molecular formula C23H31BClNO5 and a molecular weight of 447.77 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-methoxyphenyl)butoxy]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 4-[4-(5-chloro-2-methoxyphenyl)butoxy]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 140765718 |
| Molecular Formula | C23H31BClNO5 |
| Molecular Weight | 447.77 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-[4-(5-chloro-2-methoxyphenyl)butoxy]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | COc1ccc(Cl)cc1CCCCOc1cc(=O)n(C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H31BClNO5/c1-22(2)23(3,4)31-24(30-22)18-15-26(5)21(27)14-20(18)29-12-8-7-9-16-13-17(25)10-11-19(16)28-6/h10-11,13-15H,7-9,12H2,1-6H3 |
| InChIKey | FVEPYDXEMUDLBV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|