C11H22BN3O2Si — CID 172644563
trimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-1-yl]silane (PubChem CID 172644563) has the molecular formula C11H22BN3O2Si and a molecular weight of 267.21 g/mol. Its IUPAC name is trimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-1-yl]silane.
| Compound Name | trimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-1-yl]silane |
|---|---|
| PubChem CID | 172644563 |
| Molecular Formula | C11H22BN3O2Si |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | trimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-1-yl]silane |
| SMILES | CC1(C)OB(c2cn([Si](C)(C)C)nn2)OC1(C)C |
| InChI | InChI=1S/C11H22BN3O2Si/c1-10(2)11(3,4)17-12(16-10)9-8-15(14-13-9)18(5,6)7/h8H,1-7H3 |
| InChIKey | RZMSYEZMBVSYAL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|