C12H16BN3O2S — CID 172644922
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-yltriazole (PubChem CID 172644922) has the molecular formula C12H16BN3O2S and a molecular weight of 277.16 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-yltriazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-yltriazole |
|---|---|
| PubChem CID | 172644922 |
| Molecular Formula | C12H16BN3O2S |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-yltriazole |
| SMILES | CC1(C)OB(c2cn(-c3cccs3)nn2)OC1(C)C |
| InChI | InChI=1S/C12H16BN3O2S/c1-11(2)12(3,4)18-13(17-11)9-8-16(15-14-9)10-6-5-7-19-10/h5-8H,1-4H3 |
| InChIKey | KVBLMCPAGOWHLA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|