C15H17BF3N3O2 — CID 172644557
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[3-(trifluoromethyl)phenyl]triazole (PubChem CID 172644557) has the molecular formula C15H17BF3N3O2 and a molecular weight of 339.13 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[3-(trifluoromethyl)phenyl]triazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[3-(trifluoromethyl)phenyl]triazole |
|---|---|
| PubChem CID | 172644557 |
| Molecular Formula | C15H17BF3N3O2 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[3-(trifluoromethyl)phenyl]triazole |
| SMILES | CC1(C)OB(c2cn(-c3cccc(C(F)(F)F)c3)nn2)OC1(C)C |
| InChI | InChI=1S/C15H17BF3N3O2/c1-13(2)14(3,4)24-16(23-13)12-9-22(21-20-12)11-7-5-6-10(8-11)15(17,18)19/h5-9H,1-4H3 |
| InChIKey | VTJYKQNEWMZEKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|