C13H16BNO2S — CID 130115418
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine (PubChem CID 130115418) has the molecular formula C13H16BNO2S and a molecular weight of 261.15 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 130115418 |
| Molecular Formula | C13H16BNO2S |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine |
| SMILES | CC1(C)OB(c2ccc3ccsc3n2)OC1(C)C |
| InChI | InChI=1S/C13H16BNO2S/c1-12(2)13(3,4)17-14(16-12)10-6-5-9-7-8-18-11(9)15-10/h5-8H,1-4H3 |
| InChIKey | UINQLAOTMCQCLP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|