C13H19BN2O2 — CID 170986505
1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]imidazole (PubChem CID 170986505) has the molecular formula C13H19BN2O2 and a molecular weight of 246.12 g/mol. Its IUPAC name is 1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]imidazole.
| Compound Name | 1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]imidazole |
|---|---|
| PubChem CID | 170986505 |
| Molecular Formula | C13H19BN2O2 |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]imidazole |
| SMILES | Cn1ccn2cc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C13H19BN2O2/c1-12(2)13(3,4)18-14(17-12)10-8-11-15(5)6-7-16(11)9-10/h6-9H,1-5H3 |
| InChIKey | QOSHXRFIYYZXMZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|