C18H29BN2O2 — CID 178050988
ethane;1-ethyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]pyrazine (PubChem CID 178050988) has the molecular formula C18H29BN2O2 and a molecular weight of 316.25 g/mol. Its IUPAC name is ethane;1-ethyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]pyrazine.
| Compound Name | ethane;1-ethyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 178050988 |
| Molecular Formula | C18H29BN2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | ethane;1-ethyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[1,2-a]pyrazine |
| SMILES | CC.CCc1nc(C)cn2cc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C16H23BN2O2.C2H6/c1-7-13-14-8-12(10-19(14)9-11(2)18-13)17-20-15(3,4)16(5,6)21-17;1-2/h8-10H,7H2,1-6H3;1-2H3 |
| InChIKey | JMJYTQCTNCRKRW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|