C18H21B53N2O2 — CID 158206193
CID 158206193 (PubChem CID 158206193) has the molecular formula C18H21B53N2O2 and a molecular weight of 870.41 g/mol.
| Compound Name | CID 158206193 |
|---|---|
| PubChem CID | 158206193 |
| Molecular Formula | C18H21B53N2O2 |
| Molecular Weight | 870.41 g/mol |
| Exact Mass | 880.65 |
| IUPAC Name | — |
| SMILES | Cc1cn2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2n1.[B]B([B])B([B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C18H21BN2O2.B52/c1-12-11-21-9-8-13-10-14(6-7-15(13)16(21)20-12)19-22-17(2,3)18(4,5)23-19;1-28(2)41(27)48(42(29(3)4)30(5)6)51(47(39(23)24)40(25)26)52(49(43(31(7)8)32(9)10)44(33(11)12)34(13)14)50(45(35(15)16)36(17)18)46(37(19)20)38(21)22/h6-11H,1-5H3; |
| InChIKey | FEFUUCFTBIYZBU-UHFFFAOYSA-N |
| XLogP | -16.71 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 75 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.41 |
| LogP ≤ 5 | -16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|