C20H26BFN2O5S — CID 175102638
[3-tert-butyl-2-fluoro-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]oxy]phenyl] carbamate (PubChem CID 175102638) has the molecular formula C20H26BFN2O5S and a molecular weight of 436.31 g/mol. Its IUPAC name is [3-tert-butyl-2-fluoro-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]oxy]phenyl] carbamate.
| Compound Name | [3-tert-butyl-2-fluoro-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]oxy]phenyl] carbamate |
|---|---|
| PubChem CID | 175102638 |
| Molecular Formula | C20H26BFN2O5S |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [3-tert-butyl-2-fluoro-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]oxy]phenyl] carbamate |
| SMILES | CC(C)(C)c1c(Oc2nc(B3OC(C)(C)C(C)(C)O3)cs2)ccc(OC(N)=O)c1F |
| InChI | InChI=1S/C20H26BFN2O5S/c1-18(2,3)14-11(8-9-12(15(14)22)26-16(23)25)27-17-24-13(10-30-17)21-28-19(4,5)20(6,7)29-21/h8-10H,1-7H3,(H2,23,25) |
| InChIKey | GGCRDFHQUULJFY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|