C20H28BF2NO5 — CID 175071163
[1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpent-3-en-2-yl] carbamate (PubChem CID 175071163) has the molecular formula C20H28BF2NO5 and a molecular weight of 411.25 g/mol. Its IUPAC name is [1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpent-3-en-2-yl] carbamate.
| Compound Name | [1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpent-3-en-2-yl] carbamate |
|---|---|
| PubChem CID | 175071163 |
| Molecular Formula | C20H28BF2NO5 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,4-dimethylpent-3-en-2-yl] carbamate |
| SMILES | CC(C)=CC(C)(COc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1F)OC(N)=O |
| InChI | InChI=1S/C20H28BF2NO5/c1-12(2)10-20(7,27-17(24)25)11-26-14-9-8-13(15(22)16(14)23)21-28-18(3,4)19(5,6)29-21/h8-10H,11H2,1-7H3,(H2,24,25) |
| InChIKey | IKCDLYIORRIURE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|