C14H19BFNO4 — CID 175348073
[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbamate (PubChem CID 175348073) has the molecular formula C14H19BFNO4 and a molecular weight of 295.12 g/mol. Its IUPAC name is [3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbamate.
| Compound Name | [3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175348073 |
| Molecular Formula | C14H19BFNO4 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbamate |
| SMILES | CC1(C)OB(c2c(F)cccc2COC(N)=O)OC1(C)C |
| InChI | InChI=1S/C14H19BFNO4/c1-13(2)14(3,4)21-15(20-13)11-9(8-19-12(17)18)6-5-7-10(11)16/h5-7H,8H2,1-4H3,(H2,17,18) |
| InChIKey | QEIHOYGYDFMNRY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|