C15H22BFN2O4 — CID 140653672
2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 140653672) has the molecular formula C15H22BFN2O4 and a molecular weight of 324.16 g/mol. Its IUPAC name is 2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | 2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 140653672 |
| Molecular Formula | C15H22BFN2O4 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | COCc1ccc(C(=O)NN)c(F)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BFN2O4/c1-14(2)15(3,4)23-16(22-14)11-9(8-21-5)6-7-10(12(11)17)13(20)19-18/h6-7H,8,18H2,1-5H3,(H,19,20) |
| InChIKey | JOIPTRWHPXKCMR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|