C36H45B3BiF3O6 — CID 138972801
tris[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]bismuthane (PubChem CID 138972801) has the molecular formula C36H45B3BiF3O6 and a molecular weight of 872.16 g/mol. Its IUPAC name is tris[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]bismuthane.
| Compound Name | tris[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]bismuthane |
|---|---|
| PubChem CID | 138972801 |
| Molecular Formula | C36H45B3BiF3O6 |
| Molecular Weight | 872.16 g/mol |
| Exact Mass | 872.33 |
| IUPAC Name | tris[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]bismuthane |
| SMILES | CC1(C)OB(c2c(F)cccc2[Bi](c2cccc(F)c2B2OC(C)(C)C(C)(C)O2)c2cccc(F)c2B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/3C12H15BFO2.Bi/c3*1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10(9)14;/h3*5-6,8H,1-4H3; |
| InChIKey | GLILOGPFCFWUJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|