C13H15B4FO3 — CID 153336553
CID 153336553 (PubChem CID 153336553) has the molecular formula C13H15B4FO3 and a molecular weight of 281.51 g/mol.
| Compound Name | CID 153336553 |
|---|---|
| PubChem CID | 153336553 |
| Molecular Formula | C13H15B4FO3 |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1cccc(F)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H15B4FO3/c1-11(2)12(3,4)21-17(20-11)10-8(18)6-5-7-9(10)19-13(14,15)16/h5-7H,1-4H3 |
| InChIKey | ZLOLCFYPJJZXBI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|