C18H25BF3NO4 — CID 138753077
N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 138753077) has the molecular formula C18H25BF3NO4 and a molecular weight of 387.21 g/mol. Its IUPAC name is N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 138753077 |
| Molecular Formula | C18H25BF3NO4 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(C)NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H25BF3NO4/c1-11(2)23-15(24)12-7-8-13(14(9-12)25-10-18(20,21)22)19-26-16(3,4)17(5,6)27-19/h7-9,11H,10H2,1-6H3,(H,23,24) |
| InChIKey | FTPCDDOUWJPNKC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|