About N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide
N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 67216334) has the molecular formula C11H11F3INO2
and a molecular weight of 373.11 g/mol. Its IUPAC name is N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide.
Molecular Properties
| Compound Name | N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide |
| PubChem CID | 67216334 |
| Molecular Formula | C11H11F3INO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CCNC(=O)c1ccc(I)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3INO2/c1-2-16-10(17)7-3-4-8(15)9(5-7)18-6-11(12,13)14/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | XXASOEIFASUCNK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide?
The IUPAC name of N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide (CID 67216334) is N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide.
What is the SMILES notation for N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide?
The canonical SMILES for N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide is CCNC(=O)c1ccc(I)c(OCC(F)(F)F)c1.
What is the InChIKey of N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide?
The InChIKey is XXASOEIFASUCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3INO2/c1-2-16-10(17)7-3-4-8(15)9(5-7)18-6-11(12,13)14/h3-5H,2,6H2,1H3,(H,16,17).
What are the key properties of N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide?
N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide has a molecular weight of 373.11 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-iodo-3-(2,2,2-trifluoroethoxy)benzamide is sourced from PubChem (CID 67216334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).