C12H14F2INO3 — CID 146034948
3-(2,2-difluoroethoxy)-4-iodo-N-(2-methoxyethyl)benzamide (PubChem CID 146034948) has the molecular formula C12H14F2INO3 and a molecular weight of 385.15 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-4-iodo-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-(2,2-difluoroethoxy)-4-iodo-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 146034948 |
| Molecular Formula | C12H14F2INO3 |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-4-iodo-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(I)c(OCC(F)F)c1 |
| InChI | InChI=1S/C12H14F2INO3/c1-18-5-4-16-12(17)8-2-3-9(15)10(6-8)19-7-11(13)14/h2-3,6,11H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | QSCDNWGXMDVJKN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|