C14H20INO3 — CID 67216621
N,N-diethyl-4-iodo-3-(2-methoxyethoxy)benzamide (PubChem CID 67216621) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is N,N-diethyl-4-iodo-3-(2-methoxyethoxy)benzamide.
| Compound Name | N,N-diethyl-4-iodo-3-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 67216621 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N,N-diethyl-4-iodo-3-(2-methoxyethoxy)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(I)c(OCCOC)c1 |
| InChI | InChI=1S/C14H20INO3/c1-4-16(5-2)14(17)11-6-7-12(15)13(10-11)19-9-8-18-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | ZQMRISRHDJYPCS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|