C13H18INO3 — CID 22831856
N,N-diethyl-4-iodo-3-(methoxymethoxy)benzamide (PubChem CID 22831856) has the molecular formula C13H18INO3 and a molecular weight of 363.20 g/mol. Its IUPAC name is N,N-diethyl-4-iodo-3-(methoxymethoxy)benzamide.
| Compound Name | N,N-diethyl-4-iodo-3-(methoxymethoxy)benzamide |
|---|---|
| PubChem CID | 22831856 |
| Molecular Formula | C13H18INO3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N,N-diethyl-4-iodo-3-(methoxymethoxy)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(I)c(OCOC)c1 |
| InChI | InChI=1S/C13H18INO3/c1-4-15(5-2)13(16)10-6-7-11(14)12(8-10)18-9-17-3/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | BNFRJOCLPZSUIJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|