C11H12F2INO2 — CID 146034942
3-(2,2-difluoroethoxy)-N-ethyl-4-iodobenzamide (PubChem CID 146034942) has the molecular formula C11H12F2INO2 and a molecular weight of 355.12 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-ethyl-4-iodobenzamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-ethyl-4-iodobenzamide |
|---|---|
| PubChem CID | 146034942 |
| Molecular Formula | C11H12F2INO2 |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-ethyl-4-iodobenzamide |
| SMILES | CCNC(=O)c1ccc(I)c(OCC(F)F)c1 |
| InChI | InChI=1S/C11H12F2INO2/c1-2-15-11(16)7-3-4-8(14)9(5-7)17-6-10(12)13/h3-5,10H,2,6H2,1H3,(H,15,16) |
| InChIKey | KHVKYGIRVADITE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|