C10H10F3IO — CID 143778642
4-ethyl-1-iodo-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 143778642) has the molecular formula C10H10F3IO and a molecular weight of 330.09 g/mol. Its IUPAC name is 4-ethyl-1-iodo-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 4-ethyl-1-iodo-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 143778642 |
| Molecular Formula | C10H10F3IO |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-ethyl-1-iodo-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CCc1ccc(I)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3IO/c1-2-7-3-4-8(14)9(5-7)15-6-10(11,12)13/h3-5H,2,6H2,1H3 |
| InChIKey | XLJGLZPABOTACQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|