C12H10I2 — CID 134461734
6-ethyl-1,4-diiodonaphthalene (PubChem CID 134461734) has the molecular formula C12H10I2 and a molecular weight of 408.02 g/mol. Its IUPAC name is 6-ethyl-1,4-diiodonaphthalene.
| Compound Name | 6-ethyl-1,4-diiodonaphthalene |
|---|---|
| PubChem CID | 134461734 |
| Molecular Formula | C12H10I2 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.89 |
| IUPAC Name | 6-ethyl-1,4-diiodonaphthalene |
| SMILES | CCc1ccc2c(I)ccc(I)c2c1 |
| InChI | InChI=1S/C12H10I2/c1-2-8-3-4-9-10(7-8)12(14)6-5-11(9)13/h3-7H,2H2,1H3 |
| InChIKey | DIQNLLOXQAFYEK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|