C22H26 — CID 145498323
2-tert-butyl-6-ethyl-9,10-dimethylanthracene (PubChem CID 145498323) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-tert-butyl-6-ethyl-9,10-dimethylanthracene.
| Compound Name | 2-tert-butyl-6-ethyl-9,10-dimethylanthracene |
|---|---|
| PubChem CID | 145498323 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-tert-butyl-6-ethyl-9,10-dimethylanthracene |
| SMILES | CCc1ccc2c(C)c3cc(C(C)(C)C)ccc3c(C)c2c1 |
| InChI | InChI=1S/C22H26/c1-7-16-8-10-18-15(3)21-13-17(22(4,5)6)9-11-19(21)14(2)20(18)12-16/h8-13H,7H2,1-6H3 |
| InChIKey | YFHPPIYHEIXKCG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|