C20H22N2O2 — CID 138585408
3-(4-tert-butylphenyl)-6-ethyl-2H-phthalazine-1,4-dione (PubChem CID 138585408) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-6-ethyl-2H-phthalazine-1,4-dione.
| Compound Name | 3-(4-tert-butylphenyl)-6-ethyl-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 138585408 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-6-ethyl-2H-phthalazine-1,4-dione |
| SMILES | CCc1ccc2c(=O)[nH]n(-c3ccc(C(C)(C)C)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C20H22N2O2/c1-5-13-6-11-16-17(12-13)19(24)22(21-18(16)23)15-9-7-14(8-10-15)20(2,3)4/h6-12H,5H2,1-4H3,(H,21,23) |
| InChIKey | HLWHEWJEFGFDIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |