C22H15F3N2O4 — CID 138585684
6-phenylmethoxy-3-[4-(trifluoromethoxy)phenyl]-2H-phthalazine-1,4-dione (PubChem CID 138585684) has the molecular formula C22H15F3N2O4 and a molecular weight of 428.37 g/mol. Its IUPAC name is 6-phenylmethoxy-3-[4-(trifluoromethoxy)phenyl]-2H-phthalazine-1,4-dione.
| Compound Name | 6-phenylmethoxy-3-[4-(trifluoromethoxy)phenyl]-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 138585684 |
| Molecular Formula | C22H15F3N2O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 6-phenylmethoxy-3-[4-(trifluoromethoxy)phenyl]-2H-phthalazine-1,4-dione |
| SMILES | O=c1[nH]n(-c2ccc(OC(F)(F)F)cc2)c(=O)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C22H15F3N2O4/c23-22(24,25)31-16-8-6-15(7-9-16)27-21(29)19-12-17(10-11-18(19)20(28)26-27)30-13-14-4-2-1-3-5-14/h1-12H,13H2,(H,26,28) |
| InChIKey | PZYVBFILXGACFX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |