C18H13NO2S — CID 162368286
8-phenylmethoxy-4H-thieno[2,3-c]isoquinolin-5-one (PubChem CID 162368286) has the molecular formula C18H13NO2S and a molecular weight of 307.37 g/mol. Its IUPAC name is 8-phenylmethoxy-4H-thieno[2,3-c]isoquinolin-5-one.
| Compound Name | 8-phenylmethoxy-4H-thieno[2,3-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 162368286 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 8-phenylmethoxy-4H-thieno[2,3-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2sccc2c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C18H13NO2S/c20-17-14-7-6-13(21-11-12-4-2-1-3-5-12)10-16(14)15-8-9-22-18(15)19-17/h1-10H,11H2,(H,19,20) |
| InChIKey | DQIYFADDZCXPMK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |