C16H13NO4 — CID 139717983
3,4-dihydroxy-7-phenylmethoxy-1H-quinolin-2-one (PubChem CID 139717983) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3,4-dihydroxy-7-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 3,4-dihydroxy-7-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139717983 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3,4-dihydroxy-7-phenylmethoxy-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(OCc3ccccc3)ccc2c(O)c1O |
| InChI | InChI=1S/C16H13NO4/c18-14-12-7-6-11(8-13(12)17-16(20)15(14)19)21-9-10-4-2-1-3-5-10/h1-8,19H,9H2,(H2,17,18,20) |
| InChIKey | NPVFXSIRVVFHFE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |