C26H32NO6PS — CID 70036637
2-methylsulfonyl-7-phenylmethoxy-9H-carbazole;triethyl phosphite (PubChem CID 70036637) has the molecular formula C26H32NO6PS and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-methylsulfonyl-7-phenylmethoxy-9H-carbazole;triethyl phosphite.
| Compound Name | 2-methylsulfonyl-7-phenylmethoxy-9H-carbazole;triethyl phosphite |
|---|---|
| PubChem CID | 70036637 |
| Molecular Formula | C26H32NO6PS |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-methylsulfonyl-7-phenylmethoxy-9H-carbazole;triethyl phosphite |
| SMILES | CCOP(OCC)OCC.CS(=O)(=O)c1ccc2c(c1)[nH]c1cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H17NO3S.C6H15O3P/c1-25(22,23)16-8-10-18-17-9-7-15(11-19(17)21-20(18)12-16)24-13-14-5-3-2-4-6-14;1-4-7-10(8-5-2)9-6-3/h2-12,21H,13H2,1H3;4-6H2,1-3H3 |
| InChIKey | XQYSCXHSZMKPJH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|