C42H26N2O4S2 — CID 135345713
5,15-bis(phenylmethoxy)-9,19-dithiophen-2-yl-1,11-diazahexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-2(7),3,5,8,12(17),13,15,18,21-nonaene-10,20-dione (PubChem CID 135345713) has the molecular formula C42H26N2O4S2 and a molecular weight of 686.81 g/mol. Its IUPAC name is 5,15-bis(phenylmethoxy)-9,19-dithiophen-2-yl-1,11-diazahexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-2(7),3,5,8,12(17),13,15,18,21-nonaene-10,20-dione.
| Compound Name | 5,15-bis(phenylmethoxy)-9,19-dithiophen-2-yl-1,11-diazahexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-2(7),3,5,8,12(17),13,15,18,21-nonaene-10,20-dione |
|---|---|
| PubChem CID | 135345713 |
| Molecular Formula | C42H26N2O4S2 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.13 |
| IUPAC Name | 5,15-bis(phenylmethoxy)-9,19-dithiophen-2-yl-1,11-diazahexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-2(7),3,5,8,12(17),13,15,18,21-nonaene-10,20-dione |
| SMILES | O=c1c(-c2cccs2)c2c3cc(OCc4ccccc4)ccc3n3c(=O)c(-c4cccs4)c4c5cc(OCc6ccccc6)ccc5n1c4c23 |
| InChI | InChI=1S/C42H26N2O4S2/c45-41-37(33-13-7-19-49-33)35-29-21-27(47-23-25-9-3-1-4-10-25)15-17-31(29)43-39(35)40-36(38(42(43)46)34-14-8-20-50-34)30-22-28(16-18-32(30)44(40)41)48-24-26-11-5-2-6-12-26/h1-22H,23-24H2 |
| InChIKey | PUDMIIKVCFGMDQ-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |