C48H39N3O3 — CID 101011137
6,16,26-tris(phenylmethoxy)-10,20,30-triazaheptacyclo[21.7.0.03,11.04,9.013,21.014,19.024,29]triaconta-1(23),3(11),4(9),5,7,13(21),14(19),15,17,24(29),25,27-dodecaene (PubChem CID 101011137) has the molecular formula C48H39N3O3 and a molecular weight of 705.86 g/mol. Its IUPAC name is 6,16,26-tris(phenylmethoxy)-10,20,30-triazaheptacyclo[21.7.0.03,11.04,9.013,21.014,19.024,29]triaconta-1(23),3(11),4(9),5,7,13(21),14(19),15,17,24(29),25,27-dodecaene.
| Compound Name | 6,16,26-tris(phenylmethoxy)-10,20,30-triazaheptacyclo[21.7.0.03,11.04,9.013,21.014,19.024,29]triaconta-1(23),3(11),4(9),5,7,13(21),14(19),15,17,24(29),25,27-dodecaene |
|---|---|
| PubChem CID | 101011137 |
| Molecular Formula | C48H39N3O3 |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.30 |
| IUPAC Name | 6,16,26-tris(phenylmethoxy)-10,20,30-triazaheptacyclo[21.7.0.03,11.04,9.013,21.014,19.024,29]triaconta-1(23),3(11),4(9),5,7,13(21),14(19),15,17,24(29),25,27-dodecaene |
| SMILES | c1ccc(COc2ccc3[nH]c4c(c3c2)Cc2[nH]c3ccc(OCc5ccccc5)cc3c2Cc2[nH]c3ccc(OCc5ccccc5)cc3c2C4)cc1 |
| InChI | InChI=1S/C48H39N3O3/c1-4-10-31(11-5-1)28-52-34-16-19-43-37(22-34)40-25-47-42(39-24-36(17-20-44(39)50-47)54-30-33-14-8-3-9-15-33)27-48-41(26-46(40)49-43)38-23-35(18-21-45(38)51-48)53-29-32-12-6-2-7-13-32/h1-24,49-51H,25-30H2 |
| InChIKey | DPPXERPASQMRTB-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|