C19H20N2O4 — CID 174635299
(3-oxo-6-phenylmethoxy-2H-indazol-1-yl) 2,2-dimethylpropanoate (PubChem CID 174635299) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3-oxo-6-phenylmethoxy-2H-indazol-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (3-oxo-6-phenylmethoxy-2H-indazol-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174635299 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3-oxo-6-phenylmethoxy-2H-indazol-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)On1[nH]c(=O)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C19H20N2O4/c1-19(2,3)18(23)25-21-16-11-14(9-10-15(16)17(22)20-21)24-12-13-7-5-4-6-8-13/h4-11H,12H2,1-3H3,(H,20,22) |
| InChIKey | IFOUHPIPUBSMPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |