C26H40 — CID 101211334
6-tert-butyl-1,2,3,4-tetrapropylnaphthalene (PubChem CID 101211334) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is 6-tert-butyl-1,2,3,4-tetrapropylnaphthalene.
| Compound Name | 6-tert-butyl-1,2,3,4-tetrapropylnaphthalene |
|---|---|
| PubChem CID | 101211334 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 6-tert-butyl-1,2,3,4-tetrapropylnaphthalene |
| SMILES | CCCc1c(CCC)c(CCC)c2cc(C(C)(C)C)ccc2c1CCC |
| InChI | InChI=1S/C26H40/c1-8-12-20-21(13-9-2)23(15-11-4)25-18-19(26(5,6)7)16-17-24(25)22(20)14-10-3/h16-18H,8-15H2,1-7H3 |
| InChIKey | CINZETZMEWYKRV-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |