C17H14Br2 — CID 141353803
9,10-dibromo-2-ethyl-6-methylanthracene (PubChem CID 141353803) has the molecular formula C17H14Br2 and a molecular weight of 378.11 g/mol. Its IUPAC name is 9,10-dibromo-2-ethyl-6-methylanthracene.
| Compound Name | 9,10-dibromo-2-ethyl-6-methylanthracene |
|---|---|
| PubChem CID | 141353803 |
| Molecular Formula | C17H14Br2 |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 9,10-dibromo-2-ethyl-6-methylanthracene |
| SMILES | CCc1ccc2c(Br)c3cc(C)ccc3c(Br)c2c1 |
| InChI | InChI=1S/C17H14Br2/c1-3-11-5-7-13-15(9-11)17(19)12-6-4-10(2)8-14(12)16(13)18/h4-9H,3H2,1-2H3 |
| InChIKey | QFLGGJLEMJIJNB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|