C16H21BF3NO3 — CID 176508254
N-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzamide (PubChem CID 176508254) has the molecular formula C16H21BF3NO3 and a molecular weight of 343.15 g/mol. Its IUPAC name is N-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176508254 |
| Molecular Formula | C16H21BF3NO3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CCNC(=O)c1ccc(C(F)(F)F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H21BF3NO3/c1-6-21-13(22)10-7-8-11(16(18,19)20)12(9-10)17-23-14(2,3)15(4,5)24-17/h7-9H,6H2,1-5H3,(H,21,22) |
| InChIKey | PBZFGJZTLAETGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|