C24H29BF3NO4 — CID 166493154
ethyl 2-ethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)anilino]benzoate (PubChem CID 166493154) has the molecular formula C24H29BF3NO4 and a molecular weight of 463.31 g/mol. Its IUPAC name is ethyl 2-ethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)anilino]benzoate.
| Compound Name | ethyl 2-ethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 166493154 |
| Molecular Formula | C24H29BF3NO4 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | ethyl 2-ethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(C(F)(F)F)c(B3OC(C)(C)C(C)(C)O3)c2)cc1CC |
| InChI | InChI=1S/C24H29BF3NO4/c1-7-15-13-16(9-11-18(15)21(30)31-8-2)29-17-10-12-19(24(26,27)28)20(14-17)25-32-22(3,4)23(5,6)33-25/h9-14,29H,7-8H2,1-6H3 |
| InChIKey | UMZRREHVQUDFSH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|