C23H26BF3N2O4 — CID 90283498
3-cyclobutyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90283498) has the molecular formula C23H26BF3N2O4 and a molecular weight of 462.28 g/mol. Its IUPAC name is 3-cyclobutyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 3-cyclobutyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90283498 |
| Molecular Formula | C23H26BF3N2O4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-cyclobutyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)Nc3cc(C(F)(F)F)ccn3)cc2OC2CCC2)OC1(C)C |
| InChI | InChI=1S/C23H26BF3N2O4/c1-21(2)22(3,4)33-24(32-21)17-9-8-14(12-18(17)31-16-6-5-7-16)20(30)29-19-13-15(10-11-28-19)23(25,26)27/h8-13,16H,5-7H2,1-4H3,(H,28,29,30) |
| InChIKey | IJDHIHIPDNJLCG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|