C14H18BBrO4 — CID 141292284
3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 141292284) has the molecular formula C14H18BBrO4 and a molecular weight of 341.01 g/mol. Its IUPAC name is 3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 141292284 |
| Molecular Formula | C14H18BBrO4 |
| Molecular Weight | 341.01 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2ccc(C(=O)O)cc2CBr)OC1(C)C |
| InChI | InChI=1S/C14H18BBrO4/c1-13(2)14(3,4)20-15(19-13)11-6-5-9(12(17)18)7-10(11)8-16/h5-7H,8H2,1-4H3,(H,17,18) |
| InChIKey | CRVSBPCZFLWBBY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.01 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|