C23H24BNO5 — CID 140925901
[5-(4-isocyanobenzoyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (PubChem CID 140925901) has the molecular formula C23H24BNO5 and a molecular weight of 405.26 g/mol. Its IUPAC name is [5-(4-isocyanobenzoyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate.
| Compound Name | [5-(4-isocyanobenzoyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 140925901 |
| Molecular Formula | C23H24BNO5 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [5-(4-isocyanobenzoyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| SMILES | [C-]#[N+]c1ccc(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(COC(C)=O)c2)cc1 |
| InChI | InChI=1S/C23H24BNO5/c1-15(26)28-14-18-13-17(21(27)16-7-10-19(25-6)11-8-16)9-12-20(18)24-29-22(2,3)23(4,5)30-24/h7-13H,14H2,1-5H3 |
| InChIKey | ZWJSEIPYIKGMAL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|